C9H10OS — CID 124511720
[(3R)-2,3-dihydro-1-benzothiophen-3-yl]methanol (PubChem CID 124511720) has the molecular formula C9H10OS and a molecular weight of 166.25 g/mol. Its IUPAC name is [(3R)-2,3-dihydro-1-benzothiophen-3-yl]methanol.
| Compound Name | [(3R)-2,3-dihydro-1-benzothiophen-3-yl]methanol |
|---|---|
| PubChem CID | 124511720 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | [(3R)-2,3-dihydro-1-benzothiophen-3-yl]methanol |
| SMILES | OC[C@@H]1CSc2ccccc21 |
| InChI | InChI=1S/C9H10OS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-4,7,10H,5-6H2/t7-/m1/s1 |
| InChIKey | NFQJRLBCTTZPGY-SSDOTTSWSA-N |
| XLogP | 1.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |