C12H17NOS — CID 79220922
3-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)propan-1-ol (PubChem CID 79220922) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)propan-1-ol.
| Compound Name | 3-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)propan-1-ol |
|---|---|
| PubChem CID | 79220922 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)propan-1-ol |
| SMILES | OCCCNCC1CSc2ccccc21 |
| InChI | InChI=1S/C12H17NOS/c14-7-3-6-13-8-10-9-15-12-5-2-1-4-11(10)12/h1-2,4-5,10,13-14H,3,6-9H2 |
| InChIKey | MTPKOEMAOPTVFU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|