C15H21NS — CID 113478802
2-cyclobutyl-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)ethanamine (PubChem CID 113478802) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 2-cyclobutyl-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)ethanamine.
| Compound Name | 2-cyclobutyl-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 113478802 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-cyclobutyl-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)ethanamine |
| SMILES | c1ccc2c(c1)SCC2CNCCC1CCC1 |
| InChI | InChI=1S/C15H21NS/c1-2-7-15-14(6-1)13(11-17-15)10-16-9-8-12-4-3-5-12/h1-2,6-7,12-13,16H,3-5,8-11H2 |
| InChIKey | OCMTZSHXEVSTNO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|