C17H26N2S — CID 79220623
N'-cyclopentyl-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-N'-methylethane-1,2-diamine (PubChem CID 79220623) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is N'-cyclopentyl-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-cyclopentyl-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 79220623 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N'-cyclopentyl-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNCC1CSc2ccccc21)C1CCCC1 |
| InChI | InChI=1S/C17H26N2S/c1-19(15-6-2-3-7-15)11-10-18-12-14-13-20-17-9-5-4-8-16(14)17/h4-5,8-9,14-15,18H,2-3,6-7,10-13H2,1H3 |
| InChIKey | GDYBXKNERDFYCY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|