C12H16ClNS — CID 79227011
2-chloro-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)propan-1-amine (PubChem CID 79227011) has the molecular formula C12H16ClNS and a molecular weight of 241.79 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)propan-1-amine.
| Compound Name | 2-chloro-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 79227011 |
| Molecular Formula | C12H16ClNS |
| Molecular Weight | 241.79 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-chloro-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)propan-1-amine |
| SMILES | CC(Cl)CNCC1CSc2ccccc21 |
| InChI | InChI=1S/C12H16ClNS/c1-9(13)6-14-7-10-8-15-12-5-3-2-4-11(10)12/h2-5,9-10,14H,6-8H2,1H3 |
| InChIKey | FPLYKWKGXCRLQH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|