About N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine
N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine (PubChem CID 115406592) has the molecular formula C11H13F2NS
and a molecular weight of 229.29 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine |
| PubChem CID | 115406592 |
| Molecular Formula | C11H13F2NS |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine |
| SMILES | FC(F)CNCC1CSc2ccccc21 |
| InChI | InChI=1S/C11H13F2NS/c12-11(13)6-14-5-8-7-15-10-4-2-1-3-9(8)10/h1-4,8,11,14H,5-7H2 |
| InChIKey | NNWBFAKSODNWOX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine?
The IUPAC name of N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine (CID 115406592) is N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine.
What is the SMILES notation for N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine?
The canonical SMILES for N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine is FC(F)CNCC1CSc2ccccc21.
What is the InChIKey of N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine?
The InChIKey is NNWBFAKSODNWOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NS/c12-11(13)6-14-5-8-7-15-10-4-2-1-3-9(8)10/h1-4,8,11,14H,5-7H2.
What are the key properties of N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine?
N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine has a molecular weight of 229.29 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2,2-difluoroethanamine is sourced from PubChem (CID 115406592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).