C12H15ClS — CID 79221601
3-(3-chlorobutyl)-2,3-dihydro-1-benzothiophene (PubChem CID 79221601) has the molecular formula C12H15ClS and a molecular weight of 226.77 g/mol. Its IUPAC name is 3-(3-chlorobutyl)-2,3-dihydro-1-benzothiophene.
| Compound Name | 3-(3-chlorobutyl)-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79221601 |
| Molecular Formula | C12H15ClS |
| Molecular Weight | 226.77 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-(3-chlorobutyl)-2,3-dihydro-1-benzothiophene |
| SMILES | CC(Cl)CCC1CSc2ccccc21 |
| InChI | InChI=1S/C12H15ClS/c1-9(13)6-7-10-8-14-12-5-3-2-4-11(10)12/h2-5,9-10H,6-8H2,1H3 |
| InChIKey | NQSLWQISENMBID-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.77 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|