C14H19BrS — CID 79226883
3-[2-(bromomethyl)-3-methylbutyl]-2,3-dihydro-1-benzothiophene (PubChem CID 79226883) has the molecular formula C14H19BrS and a molecular weight of 299.28 g/mol. Its IUPAC name is 3-[2-(bromomethyl)-3-methylbutyl]-2,3-dihydro-1-benzothiophene.
| Compound Name | 3-[2-(bromomethyl)-3-methylbutyl]-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79226883 |
| Molecular Formula | C14H19BrS |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-[2-(bromomethyl)-3-methylbutyl]-2,3-dihydro-1-benzothiophene |
| SMILES | CC(C)C(CBr)CC1CSc2ccccc21 |
| InChI | InChI=1S/C14H19BrS/c1-10(2)11(8-15)7-12-9-16-14-6-4-3-5-13(12)14/h3-6,10-12H,7-9H2,1-2H3 |
| InChIKey | CPAIYJVRHDFOLU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|