C17H18FNS — CID 79224724
N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2-(2-fluorophenyl)ethanamine (PubChem CID 79224724) has the molecular formula C17H18FNS and a molecular weight of 287.40 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2-(2-fluorophenyl)ethanamine.
| Compound Name | N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 79224724 |
| Molecular Formula | C17H18FNS |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-2-(2-fluorophenyl)ethanamine |
| SMILES | Fc1ccccc1CCNCC1CSc2ccccc21 |
| InChI | InChI=1S/C17H18FNS/c18-16-7-3-1-5-13(16)9-10-19-11-14-12-20-17-8-4-2-6-15(14)17/h1-8,14,19H,9-12H2 |
| InChIKey | AMIPUWJYLTYBMR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|