C13H17NO2S — CID 79221635
4-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)butanoic acid (PubChem CID 79221635) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)butanoic acid.
| Compound Name | 4-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)butanoic acid |
|---|---|
| PubChem CID | 79221635 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 4-(2,3-dihydro-1-benzothiophen-3-ylmethylamino)butanoic acid |
| SMILES | O=C(O)CCCNCC1CSc2ccccc21 |
| InChI | InChI=1S/C13H17NO2S/c15-13(16)6-3-7-14-8-10-9-17-12-5-2-1-4-11(10)12/h1-2,4-5,10,14H,3,6-9H2,(H,15,16) |
| InChIKey | SRGOGGMYPYKYFS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|