C17H17F2NS — CID 79206157
2-(3,5-difluorophenyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)ethanamine (PubChem CID 79206157) has the molecular formula C17H17F2NS and a molecular weight of 305.39 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)ethanamine.
| Compound Name | 2-(3,5-difluorophenyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 79206157 |
| Molecular Formula | C17H17F2NS |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)ethanamine |
| SMILES | Fc1cc(F)cc(CCNCC2CSc3ccccc32)c1 |
| InChI | InChI=1S/C17H17F2NS/c18-14-7-12(8-15(19)9-14)5-6-20-10-13-11-21-17-4-2-1-3-16(13)17/h1-4,7-9,13,20H,5-6,10-11H2 |
| InChIKey | DWCDRKLSCGIFQP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|