C11H15NS2 — CID 79221485
2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)ethanamine (PubChem CID 79221485) has the molecular formula C11H15NS2 and a molecular weight of 225.38 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)ethanamine.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 79221485 |
| Molecular Formula | C11H15NS2 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)ethanamine |
| SMILES | NCCSCC1CSc2ccccc21 |
| InChI | InChI=1S/C11H15NS2/c12-5-6-13-7-9-8-14-11-4-2-1-3-10(9)11/h1-4,9H,5-8,12H2 |
| InChIKey | FQJDLATVLMYGBO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|