C15H23NS2 — CID 79326328
2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)-N,N-diethylethanamine (PubChem CID 79326328) has the molecular formula C15H23NS2 and a molecular weight of 281.49 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)-N,N-diethylethanamine.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 79326328 |
| Molecular Formula | C15H23NS2 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethylsulfanyl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCSCC1CSc2ccccc21 |
| InChI | InChI=1S/C15H23NS2/c1-3-16(4-2)9-10-17-11-13-12-18-15-8-6-5-7-14(13)15/h5-8,13H,3-4,9-12H2,1-2H3 |
| InChIKey | DWSYIXXQGIZBNM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|