C16H24BrNS — CID 80691843
N-(2-bromoethyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)pentan-3-amine (PubChem CID 80691843) has the molecular formula C16H24BrNS and a molecular weight of 342.35 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)pentan-3-amine.
| Compound Name | N-(2-bromoethyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)pentan-3-amine |
|---|---|
| PubChem CID | 80691843 |
| Molecular Formula | C16H24BrNS |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)pentan-3-amine |
| SMILES | CCC(CC)N(CCBr)CC1CSc2ccccc21 |
| InChI | InChI=1S/C16H24BrNS/c1-3-14(4-2)18(10-9-17)11-13-12-19-16-8-6-5-7-15(13)16/h5-8,13-14H,3-4,9-12H2,1-2H3 |
| InChIKey | LGRRILWGCTVBNK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|