C16H22BrNOS — CID 80671289
N-(2-bromoethyl)-N-pentan-3-yl-2,3-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 80671289) has the molecular formula C16H22BrNOS and a molecular weight of 356.33 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-pentan-3-yl-2,3-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-pentan-3-yl-2,3-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 80671289 |
| Molecular Formula | C16H22BrNOS |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N-(2-bromoethyl)-N-pentan-3-yl-2,3-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | CCC(CC)N(CCBr)C(=O)C1CSc2ccccc21 |
| InChI | InChI=1S/C16H22BrNOS/c1-3-12(4-2)18(10-9-17)16(19)14-11-20-15-8-6-5-7-13(14)15/h5-8,12,14H,3-4,9-11H2,1-2H3 |
| InChIKey | LZOUIARPBAZEGC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|