C13H16OS — CID 105086614
1-(2,3-dihydro-1-benzothiophen-3-yl)pentan-1-one (PubChem CID 105086614) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-3-yl)pentan-1-one.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 105086614 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)pentan-1-one |
| SMILES | CCCCC(=O)C1CSc2ccccc21 |
| InChI | InChI=1S/C13H16OS/c1-2-3-7-12(14)11-9-15-13-8-5-4-6-10(11)13/h4-6,8,11H,2-3,7,9H2,1H3 |
| InChIKey | URDLCXYOQLZYAU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |