C19H28OS — CID 105091464
1-(2,3-dihydro-1-benzothiophen-3-yl)undecan-1-one (PubChem CID 105091464) has the molecular formula C19H28OS and a molecular weight of 304.50 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-3-yl)undecan-1-one.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)undecan-1-one |
|---|---|
| PubChem CID | 105091464 |
| Molecular Formula | C19H28OS |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)undecan-1-one |
| SMILES | CCCCCCCCCCC(=O)C1CSc2ccccc21 |
| InChI | InChI=1S/C19H28OS/c1-2-3-4-5-6-7-8-9-13-18(20)17-15-21-19-14-11-10-12-16(17)19/h10-12,14,17H,2-9,13,15H2,1H3 |
| InChIKey | PXVXUDDZFZOOES-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|