C12H17ClN2OS — CID 119407943
N-(3-aminopropyl)-2,3-dihydro-1-benzothiophene-3-carboxamide;hydrochloride (PubChem CID 119407943) has the molecular formula C12H17ClN2OS and a molecular weight of 272.80 g/mol. Its IUPAC name is N-(3-aminopropyl)-2,3-dihydro-1-benzothiophene-3-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-2,3-dihydro-1-benzothiophene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119407943 |
| Molecular Formula | C12H17ClN2OS |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-(3-aminopropyl)-2,3-dihydro-1-benzothiophene-3-carboxamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)C1CSc2ccccc21 |
| InChI | InChI=1S/C12H16N2OS.ClH/c13-6-3-7-14-12(15)10-8-16-11-5-2-1-4-9(10)11;/h1-2,4-5,10H,3,6-8,13H2,(H,14,15);1H |
| InChIKey | KGCZRCAYWXENAK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|