C12H11NOS — CID 78993620
N-prop-2-ynyl-2,3-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 78993620) has the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. Its IUPAC name is N-prop-2-ynyl-2,3-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-prop-2-ynyl-2,3-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 78993620 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | N-prop-2-ynyl-2,3-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | C#CCNC(=O)C1CSc2ccccc21 |
| InChI | InChI=1S/C12H11NOS/c1-2-7-13-12(14)10-8-15-11-6-4-3-5-9(10)11/h1,3-6,10H,7-8H2,(H,13,14) |
| InChIKey | YFMHNPULRYCZMQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|