C13H16ClNOS — CID 106845501
N-(4-chlorobutyl)-2,3-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 106845501) has the molecular formula C13H16ClNOS and a molecular weight of 269.80 g/mol. Its IUPAC name is N-(4-chlorobutyl)-2,3-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(4-chlorobutyl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 106845501 |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | N-(4-chlorobutyl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NCCCCCl)C1CSc2ccccc21 |
| InChI | InChI=1S/C13H16ClNOS/c14-7-3-4-8-15-13(16)11-9-17-12-6-2-1-5-10(11)12/h1-2,5-6,11H,3-4,7-9H2,(H,15,16) |
| InChIKey | RHWIHDHGAJZWRP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|