C15H20ClNO — CID 107847144
N-(6-chlorohexyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide (PubChem CID 107847144) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is N-(6-chlorohexyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide.
| Compound Name | N-(6-chlorohexyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
|---|---|
| PubChem CID | 107847144 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-(6-chlorohexyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
| SMILES | O=C(NCCCCCCCl)C1Cc2ccccc21 |
| InChI | InChI=1S/C15H20ClNO/c16-9-5-1-2-6-10-17-15(18)14-11-12-7-3-4-8-13(12)14/h3-4,7-8,14H,1-2,5-6,9-11H2,(H,17,18) |
| InChIKey | NIKFBGSITNLVTH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|