C11H12ClNO — CID 66396131
N-(2-chloroethyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide (PubChem CID 66396131) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is N-(2-chloroethyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide.
| Compound Name | N-(2-chloroethyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
|---|---|
| PubChem CID | 66396131 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | N-(2-chloroethyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
| SMILES | O=C(NCCCl)C1Cc2ccccc21 |
| InChI | InChI=1S/C11H12ClNO/c12-5-6-13-11(14)10-7-8-3-1-2-4-9(8)10/h1-4,10H,5-7H2,(H,13,14) |
| InChIKey | SGCDROLFCYQHPT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|