C14H18BrNOS — CID 113496387
N-(1-bromopentan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 113496387) has the molecular formula C14H18BrNOS and a molecular weight of 328.28 g/mol. Its IUPAC name is N-(1-bromopentan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(1-bromopentan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 113496387 |
| Molecular Formula | C14H18BrNOS |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-(1-bromopentan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | CCC(CCBr)NC(=O)C1CSc2ccccc21 |
| InChI | InChI=1S/C14H18BrNOS/c1-2-10(7-8-15)16-14(17)12-9-18-13-6-4-3-5-11(12)13/h3-6,10,12H,2,7-9H2,1H3,(H,16,17) |
| InChIKey | AAVLUDVQXWHFJB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|