C12H14O2S — CID 19081469
ethyl 2-(2,3-dihydro-1-benzothiophen-3-yl)acetate (PubChem CID 19081469) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is ethyl 2-(2,3-dihydro-1-benzothiophen-3-yl)acetate.
| Compound Name | ethyl 2-(2,3-dihydro-1-benzothiophen-3-yl)acetate |
|---|---|
| PubChem CID | 19081469 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | ethyl 2-(2,3-dihydro-1-benzothiophen-3-yl)acetate |
| SMILES | CCOC(=O)CC1CSc2ccccc21 |
| InChI | InChI=1S/C12H14O2S/c1-2-14-12(13)7-9-8-15-11-6-4-3-5-10(9)11/h3-6,9H,2,7-8H2,1H3 |
| InChIKey | HCBOLGKVPOFYGL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |