C17H18O2S — CID 79403765
3-[(2-ethoxyphenoxy)methyl]-2,3-dihydro-1-benzothiophene (PubChem CID 79403765) has the molecular formula C17H18O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is 3-[(2-ethoxyphenoxy)methyl]-2,3-dihydro-1-benzothiophene.
| Compound Name | 3-[(2-ethoxyphenoxy)methyl]-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79403765 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-[(2-ethoxyphenoxy)methyl]-2,3-dihydro-1-benzothiophene |
| SMILES | CCOc1ccccc1OCC1CSc2ccccc21 |
| InChI | InChI=1S/C17H18O2S/c1-2-18-15-8-4-5-9-16(15)19-11-13-12-20-17-10-6-3-7-14(13)17/h3-10,13H,2,11-12H2,1H3 |
| InChIKey | HWXYHRBDRSKIRU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |