C15H13IOS — CID 79220634
3-[(2-iodophenoxy)methyl]-2,3-dihydro-1-benzothiophene (PubChem CID 79220634) has the molecular formula C15H13IOS and a molecular weight of 368.24 g/mol. Its IUPAC name is 3-[(2-iodophenoxy)methyl]-2,3-dihydro-1-benzothiophene.
| Compound Name | 3-[(2-iodophenoxy)methyl]-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79220634 |
| Molecular Formula | C15H13IOS |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 3-[(2-iodophenoxy)methyl]-2,3-dihydro-1-benzothiophene |
| SMILES | Ic1ccccc1OCC1CSc2ccccc21 |
| InChI | InChI=1S/C15H13IOS/c16-13-6-2-3-7-14(13)17-9-11-10-18-15-8-4-1-5-12(11)15/h1-8,11H,9-10H2 |
| InChIKey | SMXFOODGJHWJNT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|