C16H22N2S2 — CID 79221101
2-[cyclopentyl(2,3-dihydro-1-benzothiophen-3-ylmethyl)amino]ethanethioamide (PubChem CID 79221101) has the molecular formula C16H22N2S2 and a molecular weight of 306.50 g/mol. Its IUPAC name is 2-[cyclopentyl(2,3-dihydro-1-benzothiophen-3-ylmethyl)amino]ethanethioamide.
| Compound Name | 2-[cyclopentyl(2,3-dihydro-1-benzothiophen-3-ylmethyl)amino]ethanethioamide |
|---|---|
| PubChem CID | 79221101 |
| Molecular Formula | C16H22N2S2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[cyclopentyl(2,3-dihydro-1-benzothiophen-3-ylmethyl)amino]ethanethioamide |
| SMILES | NC(=S)CN(CC1CSc2ccccc21)C1CCCC1 |
| InChI | InChI=1S/C16H22N2S2/c17-16(19)10-18(13-5-1-2-6-13)9-12-11-20-15-8-4-3-7-14(12)15/h3-4,7-8,12-13H,1-2,5-6,9-11H2,(H2,17,19) |
| InChIKey | NBJUTTXKBXGKCA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|