C16H20N2OS2 — CID 79211877
N-(2-amino-2-sulfanylideneethyl)-N-cyclopentyl-2,3-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 79211877) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N-cyclopentyl-2,3-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N-cyclopentyl-2,3-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79211877 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N-cyclopentyl-2,3-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=S)CN(C(=O)C1CSc2ccccc21)C1CCCC1 |
| InChI | InChI=1S/C16H20N2OS2/c17-15(20)9-18(11-5-1-2-6-11)16(19)13-10-21-14-8-4-3-7-12(13)14/h3-4,7-8,11,13H,1-2,5-6,9-10H2,(H2,17,20) |
| InChIKey | NQBUZVSNYSLKLX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|