C12H23Cl2N — CID 11075940
N,N-bis(2-chloroethyl)cyclooctanamine (PubChem CID 11075940) has the molecular formula C12H23Cl2N and a molecular weight of 252.23 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)cyclooctanamine.
| Compound Name | N,N-bis(2-chloroethyl)cyclooctanamine |
|---|---|
| PubChem CID | 11075940 |
| Molecular Formula | C12H23Cl2N |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N,N-bis(2-chloroethyl)cyclooctanamine |
| SMILES | ClCCN(CCCl)C1CCCCCCC1 |
| InChI | InChI=1S/C12H23Cl2N/c13-8-10-15(11-9-14)12-6-4-2-1-3-5-7-12/h12H,1-11H2 |
| InChIKey | JZLVPSUROKRFMZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|