C12H21ClF3N — CID 115518352
N-(2-chloroethyl)-N-(4,4,4-trifluorobutyl)cyclohexanamine (PubChem CID 115518352) has the molecular formula C12H21ClF3N and a molecular weight of 271.75 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(4,4,4-trifluorobutyl)cyclohexanamine.
| Compound Name | N-(2-chloroethyl)-N-(4,4,4-trifluorobutyl)cyclohexanamine |
|---|---|
| PubChem CID | 115518352 |
| Molecular Formula | C12H21ClF3N |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-(2-chloroethyl)-N-(4,4,4-trifluorobutyl)cyclohexanamine |
| SMILES | FC(F)(F)CCCN(CCCl)C1CCCCC1 |
| InChI | InChI=1S/C12H21ClF3N/c13-8-10-17(9-4-7-12(14,15)16)11-5-2-1-3-6-11/h11H,1-10H2 |
| InChIKey | KTMDMUHDSOBJIG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|