C11H19ClF3N — CID 107489081
N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)cycloheptanamine (PubChem CID 107489081) has the molecular formula C11H19ClF3N and a molecular weight of 257.73 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)cycloheptanamine.
| Compound Name | N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)cycloheptanamine |
|---|---|
| PubChem CID | 107489081 |
| Molecular Formula | C11H19ClF3N |
| Molecular Weight | 257.73 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)cycloheptanamine |
| SMILES | FC(F)(F)CN(CCCl)C1CCCCCC1 |
| InChI | InChI=1S/C11H19ClF3N/c12-7-8-16(9-11(13,14)15)10-5-3-1-2-4-6-10/h10H,1-9H2 |
| InChIKey | JJMJDBWJUWGVTP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.73 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|