methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate

C12H20F3NO2 — CID 113330874

IUPACmethyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate
SMILESCOC(=O)CN(CCCC(F)(F)F)C1CCCC1
InChIInChI=1S/C12H20F3NO2/c1-18-11(17)9-16(10-5-2-3-6-10)8-4-7-12(13,14)15/h10H,2-9H2,1H3
InChIKeyRESXDNRSKNZKGW-UHFFFAOYSA-N
MW267.29 g/mol
LogP2.75
Rot. Bonds6

About methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate

methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate (PubChem CID 113330874) has the molecular formula C12H20F3NO2 and a molecular weight of 267.29 g/mol. Its IUPAC name is methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate
PubChem CID113330874
Molecular FormulaC12H20F3NO2
Molecular Weight267.29 g/mol
Exact Mass267.14
IUPAC Namemethyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate
SMILESCOC(=O)CN(CCCC(F)(F)F)C1CCCC1
InChIInChI=1S/C12H20F3NO2/c1-18-11(17)9-16(10-5-2-3-6-10)8-4-7-12(13,14)15/h10H,2-9H2,1H3
InChIKeyRESXDNRSKNZKGW-UHFFFAOYSA-N
XLogP2.75
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.29
LogP ≤ 52.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate?
The IUPAC name of methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate (CID 113330874) is methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate.
What is the SMILES notation for methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate?
The canonical SMILES for methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate is COC(=O)CN(CCCC(F)(F)F)C1CCCC1.
What is the InChIKey of methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate?
The InChIKey is RESXDNRSKNZKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3NO2/c1-18-11(17)9-16(10-5-2-3-6-10)8-4-7-12(13,14)15/h10H,2-9H2,1H3.
What are the key properties of methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate?
methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate has a molecular weight of 267.29 g/mol, XLogP of 2.75, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[cyclopentyl(4,4,4-trifluorobutyl)amino]acetate is sourced from PubChem (CID 113330874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).