About 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel
2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel (PubChem CID 88833532) has the molecular formula C10H21NNiO2
and a molecular weight of 245.98 g/mol. Its IUPAC name is 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel.
Molecular Properties
| Compound Name | 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel |
| PubChem CID | 88833532 |
| Molecular Formula | C10H21NNiO2 |
| Molecular Weight | 245.98 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel |
| SMILES | OCCN(CCO)C1CCCCC1.[Ni] |
| InChI | InChI=1S/C10H21NO2.Ni/c12-8-6-11(7-9-13)10-4-2-1-3-5-10;/h10,12-13H,1-9H2; |
| InChIKey | MKXHIWRWTSENBU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.98 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel?
The IUPAC name of 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel (CID 88833532) is 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel.
What is the SMILES notation for 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel?
The canonical SMILES for 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel is OCCN(CCO)C1CCCCC1.[Ni].
What is the InChIKey of 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel?
The InChIKey is MKXHIWRWTSENBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2.Ni/c12-8-6-11(7-9-13)10-4-2-1-3-5-10;/h10,12-13H,1-9H2;.
What are the key properties of 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel?
2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel has a molecular weight of 245.98 g/mol, XLogP of 0.60, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol;nickel is sourced from PubChem (CID 88833532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).