C10H19F2NO — CID 62016408
2-[cyclohexyl(2,2-difluoroethyl)amino]ethanol (PubChem CID 62016408) has the molecular formula C10H19F2NO and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-[cyclohexyl(2,2-difluoroethyl)amino]ethanol.
| Compound Name | 2-[cyclohexyl(2,2-difluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 62016408 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-[cyclohexyl(2,2-difluoroethyl)amino]ethanol |
| SMILES | OCCN(CC(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H19F2NO/c11-10(12)8-13(6-7-14)9-4-2-1-3-5-9/h9-10,14H,1-8H2 |
| InChIKey | JZDATRHFCKHCAP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |