C9H19NO3 — CID 102867765
3-[cyclobutyl(2-hydroxyethyl)amino]propane-1,2-diol (PubChem CID 102867765) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is 3-[cyclobutyl(2-hydroxyethyl)amino]propane-1,2-diol.
| Compound Name | 3-[cyclobutyl(2-hydroxyethyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 102867765 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 3-[cyclobutyl(2-hydroxyethyl)amino]propane-1,2-diol |
| SMILES | OCCN(CC(O)CO)C1CCC1 |
| InChI | InChI=1S/C9H19NO3/c11-5-4-10(6-9(13)7-12)8-2-1-3-8/h8-9,11-13H,1-7H2 |
| InChIKey | SHTLWVSBLMBVMJ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |