C10H20N2O2S — CID 82851165
2-[cyclopentyl(2,3-dihydroxypropyl)amino]ethanethioamide (PubChem CID 82851165) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 2-[cyclopentyl(2,3-dihydroxypropyl)amino]ethanethioamide.
| Compound Name | 2-[cyclopentyl(2,3-dihydroxypropyl)amino]ethanethioamide |
|---|---|
| PubChem CID | 82851165 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-[cyclopentyl(2,3-dihydroxypropyl)amino]ethanethioamide |
| SMILES | NC(=S)CN(CC(O)CO)C1CCCC1 |
| InChI | InChI=1S/C10H20N2O2S/c11-10(15)6-12(5-9(14)7-13)8-3-1-2-4-8/h8-9,13-14H,1-7H2,(H2,11,15) |
| InChIKey | BQVYSYRIAQJJIY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|