C10H21N3O3 — CID 82849875
2-[2,3-dihydroxypropyl(piperidin-4-yl)amino]acetamide (PubChem CID 82849875) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-[2,3-dihydroxypropyl(piperidin-4-yl)amino]acetamide.
| Compound Name | 2-[2,3-dihydroxypropyl(piperidin-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 82849875 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-[2,3-dihydroxypropyl(piperidin-4-yl)amino]acetamide |
| SMILES | NC(=O)CN(CC(O)CO)C1CCNCC1 |
| InChI | InChI=1S/C10H21N3O3/c11-10(16)6-13(5-9(15)7-14)8-1-3-12-4-2-8/h8-9,12,14-15H,1-7H2,(H2,11,16) |
| InChIKey | YHTZQMDKUZXDAP-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |