C10H19Cl2N3O — CID 138040175
2-[piperidin-4-yl(prop-2-ynyl)amino]acetamide;dihydrochloride (PubChem CID 138040175) has the molecular formula C10H19Cl2N3O and a molecular weight of 268.19 g/mol. Its IUPAC name is 2-[piperidin-4-yl(prop-2-ynyl)amino]acetamide;dihydrochloride.
| Compound Name | 2-[piperidin-4-yl(prop-2-ynyl)amino]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 138040175 |
| Molecular Formula | C10H19Cl2N3O |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-[piperidin-4-yl(prop-2-ynyl)amino]acetamide;dihydrochloride |
| SMILES | C#CCN(CC(N)=O)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C10H17N3O.2ClH/c1-2-7-13(8-10(11)14)9-3-5-12-6-4-9;;/h1,9,12H,3-8H2,(H2,11,14);2*1H |
| InChIKey | QQPYAADMNZAYQJ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|