C17H38Cl2N2O10 — CID 138560502
6-[2,3,4,5,6-pentahydroxyhexyl(piperidin-4-yl)amino]hexane-1,2,3,4,5-pentol;dihydrochloride (PubChem CID 138560502) has the molecular formula C17H38Cl2N2O10 and a molecular weight of 501.40 g/mol. Its IUPAC name is 6-[2,3,4,5,6-pentahydroxyhexyl(piperidin-4-yl)amino]hexane-1,2,3,4,5-pentol;dihydrochloride.
| Compound Name | 6-[2,3,4,5,6-pentahydroxyhexyl(piperidin-4-yl)amino]hexane-1,2,3,4,5-pentol;dihydrochloride |
|---|---|
| PubChem CID | 138560502 |
| Molecular Formula | C17H38Cl2N2O10 |
| Molecular Weight | 501.40 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 6-[2,3,4,5,6-pentahydroxyhexyl(piperidin-4-yl)amino]hexane-1,2,3,4,5-pentol;dihydrochloride |
| SMILES | Cl.Cl.OCC(O)C(O)C(O)C(O)CN(CC(O)C(O)C(O)C(O)CO)C1CCNCC1 |
| InChI | InChI=1S/C17H36N2O10.2ClH/c20-7-12(24)16(28)14(26)10(22)5-19(9-1-3-18-4-2-9)6-11(23)15(27)17(29)13(25)8-21;;/h9-18,20-29H,1-8H2;2*1H |
| InChIKey | IKIFHQBUQMTSBC-UHFFFAOYSA-N |
| XLogP | -5.24 |
| TPSA | 217.57 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.40 |
| LogP ≤ 5 | -5.24 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |