C16H34N2O8 — CID 134560586
(3R,4S,5S)-6-[[(3S)-pyrrolidin-3-yl]-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]amino]hexane-1,3,4,5-tetrol (PubChem CID 134560586) has the molecular formula C16H34N2O8 and a molecular weight of 382.45 g/mol. Its IUPAC name is (3R,4S,5S)-6-[[(3S)-pyrrolidin-3-yl]-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]amino]hexane-1,3,4,5-tetrol.
| Compound Name | (3R,4S,5S)-6-[[(3S)-pyrrolidin-3-yl]-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]amino]hexane-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 134560586 |
| Molecular Formula | C16H34N2O8 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | (3R,4S,5S)-6-[[(3S)-pyrrolidin-3-yl]-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]amino]hexane-1,3,4,5-tetrol |
| SMILES | OCC[C@@H](O)[C@H](O)[C@@H](O)CN(C[C@H](O)[C@@H](O)[C@H](O)CCO)[C@H]1CCNC1 |
| InChI | InChI=1S/C16H34N2O8/c19-5-2-11(21)15(25)13(23)8-18(10-1-4-17-7-10)9-14(24)16(26)12(22)3-6-20/h10-17,19-26H,1-9H2/t10-,11+,12+,13-,14-,15-,16-/m0/s1 |
| InChIKey | IAGHZEFHRWGRNV-CYINXLQVSA-N |
| XLogP | -4.42 |
| TPSA | 177.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |