C16H34N2O10 — CID 139580950
6-[2,3,4,5,6-pentahydroxyhexyl-[(3S)-pyrrolidin-3-yl]amino]hexane-1,2,3,4,5-pentol (PubChem CID 139580950) has the molecular formula C16H34N2O10 and a molecular weight of 414.45 g/mol. Its IUPAC name is 6-[2,3,4,5,6-pentahydroxyhexyl-[(3S)-pyrrolidin-3-yl]amino]hexane-1,2,3,4,5-pentol.
| Compound Name | 6-[2,3,4,5,6-pentahydroxyhexyl-[(3S)-pyrrolidin-3-yl]amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 139580950 |
| Molecular Formula | C16H34N2O10 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 6-[2,3,4,5,6-pentahydroxyhexyl-[(3S)-pyrrolidin-3-yl]amino]hexane-1,2,3,4,5-pentol |
| SMILES | OCC(O)C(O)C(O)C(O)CN(CC(O)C(O)C(O)C(O)CO)[C@H]1CCNC1 |
| InChI | InChI=1S/C16H34N2O10/c19-6-11(23)15(27)13(25)9(21)4-18(8-1-2-17-3-8)5-10(22)14(26)16(28)12(24)7-20/h8-17,19-28H,1-7H2/t8-,9?,10?,11?,12?,13?,14?,15?,16?/m0/s1 |
| InChIKey | RWNGZLADINGRPM-NXFPAFRJSA-N |
| XLogP | -6.48 |
| TPSA | 217.57 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | -6.48 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |