C16H35N3O7 — CID 138576842
(2R,3R,4R,5S)-6-[[1-(2-aminoethyl)piperidin-4-yl]-[(2S)-2,3-dihydroxypropyl]amino]hexane-1,2,3,4,5-pentol (PubChem CID 138576842) has the molecular formula C16H35N3O7 and a molecular weight of 381.47 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[[1-(2-aminoethyl)piperidin-4-yl]-[(2S)-2,3-dihydroxypropyl]amino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[[1-(2-aminoethyl)piperidin-4-yl]-[(2S)-2,3-dihydroxypropyl]amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 138576842 |
| Molecular Formula | C16H35N3O7 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | (2R,3R,4R,5S)-6-[[1-(2-aminoethyl)piperidin-4-yl]-[(2S)-2,3-dihydroxypropyl]amino]hexane-1,2,3,4,5-pentol |
| SMILES | NCCN1CCC(N(C[C@H](O)CO)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)CC1 |
| InChI | InChI=1S/C16H35N3O7/c17-3-6-18-4-1-11(2-5-18)19(7-12(22)9-20)8-13(23)15(25)16(26)14(24)10-21/h11-16,20-26H,1-10,17H2/t12-,13-,14+,15+,16+/m0/s1 |
| InChIKey | IWFOSBUVWFOSBQ-AALSBFMBSA-N |
| XLogP | -4.50 |
| TPSA | 174.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |