C14H34Cl2N2O10 — CID 139580803
(2R,3R,4R,5S)-6-[2-aminoethyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol;dihydrochloride (PubChem CID 139580803) has the molecular formula C14H34Cl2N2O10 and a molecular weight of 461.34 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[2-aminoethyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol;dihydrochloride.
| Compound Name | (2R,3R,4R,5S)-6-[2-aminoethyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol;dihydrochloride |
|---|---|
| PubChem CID | 139580803 |
| Molecular Formula | C14H34Cl2N2O10 |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | (2R,3R,4R,5S)-6-[2-aminoethyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol;dihydrochloride |
| SMILES | Cl.Cl.NCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H32N2O10.2ClH/c15-1-2-16(3-7(19)11(23)13(25)9(21)5-17)4-8(20)12(24)14(26)10(22)6-18;;/h7-14,17-26H,1-6,15H2;2*1H/t7-,8-,9+,10+,11+,12+,13+,14+;;/m0../s1 |
| InChIKey | DLRIOQCRHRYWOE-HIIUJFRBSA-N |
| XLogP | -6.04 |
| TPSA | 231.56 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | -6.04 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |