C16H35NO11 — CID 122500972
(2R,3R,4R,5S)-6-[3-methoxypropyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol (PubChem CID 122500972) has the molecular formula C16H35NO11 and a molecular weight of 417.45 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[3-methoxypropyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[3-methoxypropyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 122500972 |
| Molecular Formula | C16H35NO11 |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (2R,3R,4R,5S)-6-[3-methoxypropyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol |
| SMILES | COCCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H35NO11/c1-28-4-2-3-17(5-9(20)13(24)15(26)11(22)7-18)6-10(21)14(25)16(27)12(23)8-19/h9-16,18-27H,2-8H2,1H3/t9-,10-,11+,12+,13+,14+,15+,16+/m0/s1 |
| InChIKey | MNTQPYFBECNXEC-UBNJRQOFSA-N |
| XLogP | -5.80 |
| TPSA | 214.77 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | -5.80 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|