C18H31NO7 — CID 126497842
(2R,3R,4R,5S)-6-[2-methoxyethyl(3-phenoxypropyl)amino]hexane-1,2,3,4,5-pentol (PubChem CID 126497842) has the molecular formula C18H31NO7 and a molecular weight of 373.45 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[2-methoxyethyl(3-phenoxypropyl)amino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[2-methoxyethyl(3-phenoxypropyl)amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 126497842 |
| Molecular Formula | C18H31NO7 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | (2R,3R,4R,5S)-6-[2-methoxyethyl(3-phenoxypropyl)amino]hexane-1,2,3,4,5-pentol |
| SMILES | COCCN(CCCOc1ccccc1)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H31NO7/c1-25-11-9-19(8-5-10-26-14-6-3-2-4-7-14)12-15(21)17(23)18(24)16(22)13-20/h2-4,6-7,15-18,20-24H,5,8-13H2,1H3/t15-,16+,17+,18+/m0/s1 |
| InChIKey | HTWOMPOVOCWPKU-BSDSXHPESA-N |
| XLogP | -1.16 |
| TPSA | 122.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|