C22H39NO11 — CID 122451727
(2R,3R,4R,5R)-6-[2-(4-ethylphenoxy)ethyl-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol (PubChem CID 122451727) has the molecular formula C22H39NO11 and a molecular weight of 493.55 g/mol. Its IUPAC name is (2R,3R,4R,5R)-6-[2-(4-ethylphenoxy)ethyl-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5R)-6-[2-(4-ethylphenoxy)ethyl-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 122451727 |
| Molecular Formula | C22H39NO11 |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | (2R,3R,4R,5R)-6-[2-(4-ethylphenoxy)ethyl-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol |
| SMILES | CCc1ccc(OCCN(C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C22H39NO11/c1-2-13-3-5-14(6-4-13)34-8-7-23(9-15(26)19(30)21(32)17(28)11-24)10-16(27)20(31)22(33)18(29)12-25/h3-6,15-22,24-33H,2,7-12H2,1H3/t15-,16-,17-,18-,19-,20-,21-,22-/m1/s1 |
| InChIKey | IBRVSHUSASQXLI-POGUXHMRSA-N |
| XLogP | -4.20 |
| TPSA | 214.77 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |