C22H37NO12 — CID 122451713
(2R,3S,4R,5R)-N-[2-(4-ethylphenoxy)ethyl]-2,3,4,5,6-pentahydroxy-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide (PubChem CID 122451713) has the molecular formula C22H37NO12 and a molecular weight of 507.53 g/mol. Its IUPAC name is (2R,3S,4R,5R)-N-[2-(4-ethylphenoxy)ethyl]-2,3,4,5,6-pentahydroxy-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide.
| Compound Name | (2R,3S,4R,5R)-N-[2-(4-ethylphenoxy)ethyl]-2,3,4,5,6-pentahydroxy-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide |
|---|---|
| PubChem CID | 122451713 |
| Molecular Formula | C22H37NO12 |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | (2R,3S,4R,5R)-N-[2-(4-ethylphenoxy)ethyl]-2,3,4,5,6-pentahydroxy-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]hexanamide |
| SMILES | CCc1ccc(OCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C22H37NO12/c1-2-12-3-5-13(6-4-12)35-8-7-23(9-14(26)17(29)18(30)15(27)10-24)22(34)21(33)20(32)19(31)16(28)11-25/h3-6,14-21,24-33H,2,7-11H2,1H3/t14-,15+,16+,17+,18+,19+,20-,21+/m0/s1 |
| InChIKey | CLRUGMHAMNNNFC-YWFCDVSRSA-N |
| XLogP | -4.67 |
| TPSA | 231.84 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |