C15H22NNaO6S2 — CID 23699669
sodium N-[(4-methoxyphenyl)methyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate (PubChem CID 23699669) has the molecular formula C15H22NNaO6S2 and a molecular weight of 399.47 g/mol. Its IUPAC name is sodium N-[(4-methoxyphenyl)methyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate.
| Compound Name | sodium N-[(4-methoxyphenyl)methyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate |
|---|---|
| PubChem CID | 23699669 |
| Molecular Formula | C15H22NNaO6S2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | sodium N-[(4-methoxyphenyl)methyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate |
| SMILES | COc1ccc(CN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=S)[S-])cc1.[Na+] |
| InChI | InChI=1S/C15H23NO6S2.Na/c1-22-10-4-2-9(3-5-10)6-16(15(23)24)7-11(18)13(20)14(21)12(19)8-17;/h2-5,11-14,17-21H,6-8H2,1H3,(H,23,24);/q;+1/p-1/t11-,12+,13+,14+;/m0./s1 |
| InChIKey | HGFNRPKBKBUOIU-PKJCYYJESA-M |
| XLogP | -4.23 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | -4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|