C9H12O3 — CID 101170566
1-(4-methoxyphenyl)(213C)ethane-1,2-diol (PubChem CID 101170566) has the molecular formula C9H12O3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)(213C)ethane-1,2-diol.
| Compound Name | 1-(4-methoxyphenyl)(213C)ethane-1,2-diol |
|---|---|
| PubChem CID | 101170566 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.08 |
| IUPAC Name | 1-(4-methoxyphenyl)(213C)ethane-1,2-diol |
| SMILES | COc1ccc(C(O)[13CH2]O)cc1 |
| InChI | InChI=1S/C9H12O3/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-5,9-11H,6H2,1H3/i6+1 |
| InChIKey | CRTWVYYKVHLMDK-PTQBSOBMSA-N |
| XLogP | 0.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |