C11H17NO3 — CID 121237727
(1S,3R)-3-amino-1-(4-methoxyphenyl)butane-1,4-diol (PubChem CID 121237727) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is (1S,3R)-3-amino-1-(4-methoxyphenyl)butane-1,4-diol.
| Compound Name | (1S,3R)-3-amino-1-(4-methoxyphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 121237727 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (1S,3R)-3-amino-1-(4-methoxyphenyl)butane-1,4-diol |
| SMILES | COc1ccc([C@@H](O)C[C@@H](N)CO)cc1 |
| InChI | InChI=1S/C11H17NO3/c1-15-10-4-2-8(3-5-10)11(14)6-9(12)7-13/h2-5,9,11,13-14H,6-7,12H2,1H3/t9-,11+/m1/s1 |
| InChIKey | VTWYVZSGLAKIGW-KOLCDFICSA-N |
| XLogP | 0.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |